C19H22F3N2O2+ — CID 8805562
(2-methoxy-5-methylphenyl)methyl-methyl-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium (PubChem CID 8805562) has the molecular formula C19H22F3N2O2+ and a molecular weight of 367.39 g/mol. Its IUPAC name is (2-methoxy-5-methylphenyl)methyl-methyl-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium.
| Compound Name | (2-methoxy-5-methylphenyl)methyl-methyl-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 8805562 |
| Molecular Formula | C19H22F3N2O2+ |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (2-methoxy-5-methylphenyl)methyl-methyl-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium |
| SMILES | COc1ccc(C)cc1C[NH+](C)[C@@H](C)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H21F3N2O2/c1-11-5-8-16(26-4)13(9-11)10-24(3)12(2)19(25)23-15-7-6-14(20)17(21)18(15)22/h5-9,12H,10H2,1-4H3,(H,23,25)/p+1/t12-/m0/s1 |
| InChIKey | XGHKBSDNQYMCPF-LBPRGKRZSA-O |
| XLogP | 2.46 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|