C17H17F3N2O3 — CID 78670468
2-(3,4-dimethoxyanilino)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 78670468) has the molecular formula C17H17F3N2O3 and a molecular weight of 354.33 g/mol. Its IUPAC name is 2-(3,4-dimethoxyanilino)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 2-(3,4-dimethoxyanilino)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 78670468 |
| Molecular Formula | C17H17F3N2O3 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-(3,4-dimethoxyanilino)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | COc1ccc(NC(C)C(=O)Nc2ccc(F)c(F)c2F)cc1OC |
| InChI | InChI=1S/C17H17F3N2O3/c1-9(21-10-4-7-13(24-2)14(8-10)25-3)17(23)22-12-6-5-11(18)15(19)16(12)20/h4-9,21H,1-3H3,(H,22,23) |
| InChIKey | UFCJQSAOGCJQPT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|