C18H18F3N3O3 — CID 2474098
(2R)-2-(5-acetamido-2-methoxyanilino)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 2474098) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is (2R)-2-(5-acetamido-2-methoxyanilino)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-(5-acetamido-2-methoxyanilino)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 2474098 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (2R)-2-(5-acetamido-2-methoxyanilino)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | COc1ccc(NC(C)=O)cc1N[C@H](C)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H18F3N3O3/c1-9(18(26)24-13-6-5-12(19)16(20)17(13)21)22-14-8-11(23-10(2)25)4-7-15(14)27-3/h4-9,22H,1-3H3,(H,23,25)(H,24,26)/t9-/m1/s1 |
| InChIKey | FUQITBRZYGKPHI-SECBINFHSA-N |
| XLogP | 3.51 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|