C15H14F3N3O2 — CID 51113240
2-[(6-methoxy-3-pyridinyl)amino]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 51113240) has the molecular formula C15H14F3N3O2 and a molecular weight of 325.29 g/mol. Its IUPAC name is 2-[(6-methoxy-3-pyridinyl)amino]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 2-[(6-methoxy-3-pyridinyl)amino]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 51113240 |
| Molecular Formula | C15H14F3N3O2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-[(6-methoxy-3-pyridinyl)amino]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | COc1ccc(NC(C)C(=O)Nc2ccc(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C15H14F3N3O2/c1-8(20-9-3-6-12(23-2)19-7-9)15(22)21-11-5-4-10(16)13(17)14(11)18/h3-8,20H,1-2H3,(H,21,22) |
| InChIKey | PBVMQLAHZOJFGA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|