C14H11Br2NO2S — CID 23249669
N-(2,4-dibromophenyl)-4-oxo-4-thiophen-2-ylbutanamide (PubChem CID 23249669) has the molecular formula C14H11Br2NO2S and a molecular weight of 417.12 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-4-oxo-4-thiophen-2-ylbutanamide.
| Compound Name | N-(2,4-dibromophenyl)-4-oxo-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 23249669 |
| Molecular Formula | C14H11Br2NO2S |
| Molecular Weight | 417.12 g/mol |
| Exact Mass | 414.89 |
| IUPAC Name | N-(2,4-dibromophenyl)-4-oxo-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCC(=O)c1cccs1)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H11Br2NO2S/c15-9-3-4-11(10(16)8-9)17-14(19)6-5-12(18)13-2-1-7-20-13/h1-4,7-8H,5-6H2,(H,17,19) |
| InChIKey | YTRYMTUWCHGQDK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.12 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |