C16H13F2NOS — CID 71908608
N-(4-ethynyl-2,6-difluorophenyl)-4-thiophen-2-ylbutanamide (PubChem CID 71908608) has the molecular formula C16H13F2NOS and a molecular weight of 305.35 g/mol. Its IUPAC name is N-(4-ethynyl-2,6-difluorophenyl)-4-thiophen-2-ylbutanamide.
| Compound Name | N-(4-ethynyl-2,6-difluorophenyl)-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 71908608 |
| Molecular Formula | C16H13F2NOS |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | N-(4-ethynyl-2,6-difluorophenyl)-4-thiophen-2-ylbutanamide |
| SMILES | C#Cc1cc(F)c(NC(=O)CCCc2cccs2)c(F)c1 |
| InChI | InChI=1S/C16H13F2NOS/c1-2-11-9-13(17)16(14(18)10-11)19-15(20)7-3-5-12-6-4-8-21-12/h1,4,6,8-10H,3,5,7H2,(H,19,20) |
| InChIKey | IGJPQARXLLNRGZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|