C13H17NOS — CID 103579001
N-pent-1-yn-3-yl-4-thiophen-2-ylbutanamide (PubChem CID 103579001) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is N-pent-1-yn-3-yl-4-thiophen-2-ylbutanamide.
| Compound Name | N-pent-1-yn-3-yl-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 103579001 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-pent-1-yn-3-yl-4-thiophen-2-ylbutanamide |
| SMILES | C#CC(CC)NC(=O)CCCc1cccs1 |
| InChI | InChI=1S/C13H17NOS/c1-3-11(4-2)14-13(15)9-5-7-12-8-6-10-16-12/h1,6,8,10-11H,4-5,7,9H2,2H3,(H,14,15) |
| InChIKey | UIONUCYYSHGXRE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|