C13H17NOS — CID 103708912
N-pent-4-ynyl-4-thiophen-2-ylbutanamide (PubChem CID 103708912) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is N-pent-4-ynyl-4-thiophen-2-ylbutanamide.
| Compound Name | N-pent-4-ynyl-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 103708912 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-pent-4-ynyl-4-thiophen-2-ylbutanamide |
| SMILES | C#CCCCNC(=O)CCCc1cccs1 |
| InChI | InChI=1S/C13H17NOS/c1-2-3-4-10-14-13(15)9-5-7-12-8-6-11-16-12/h1,6,8,11H,3-5,7,9-10H2,(H,14,15) |
| InChIKey | SCDOGZFOFFODQC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|