C12H19N3O2S — CID 76953161
N-(4-amino-4-hydroxyiminobutyl)-4-thiophen-2-ylbutanamide (PubChem CID 76953161) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-(4-amino-4-hydroxyiminobutyl)-4-thiophen-2-ylbutanamide.
| Compound Name | N-(4-amino-4-hydroxyiminobutyl)-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 76953161 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(4-amino-4-hydroxyiminobutyl)-4-thiophen-2-ylbutanamide |
| SMILES | NC(CCCNC(=O)CCCc1cccs1)=NO |
| InChI | InChI=1S/C12H19N3O2S/c13-11(15-17)6-2-8-14-12(16)7-1-4-10-5-3-9-18-10/h3,5,9,17H,1-2,4,6-8H2,(H2,13,15)(H,14,16) |
| InChIKey | PUDRAQOQZBVOLU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|