C16H15N3OS2 — CID 17444449
N-(5-phenyl-1,3,4-thiadiazol-2-yl)-4-thiophen-2-ylbutanamide (PubChem CID 17444449) has the molecular formula C16H15N3OS2 and a molecular weight of 329.45 g/mol. Its IUPAC name is N-(5-phenyl-1,3,4-thiadiazol-2-yl)-4-thiophen-2-ylbutanamide.
| Compound Name | N-(5-phenyl-1,3,4-thiadiazol-2-yl)-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 17444449 |
| Molecular Formula | C16H15N3OS2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | N-(5-phenyl-1,3,4-thiadiazol-2-yl)-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C16H15N3OS2/c20-14(10-4-8-13-9-5-11-21-13)17-16-19-18-15(22-16)12-6-2-1-3-7-12/h1-3,5-7,9,11H,4,8,10H2,(H,17,19,20) |
| InChIKey | MRBXECAMMNWFSV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |