C27H38N4O2S — CID 25414893
1-(1-adamantyl)-3-[(1R,5S)-8-[(4-ethoxyphenyl)carbamothioyl]-8-azabicyclo[3.2.1]octan-3-yl]urea (PubChem CID 25414893) has the molecular formula C27H38N4O2S and a molecular weight of 482.69 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(1R,5S)-8-[(4-ethoxyphenyl)carbamothioyl]-8-azabicyclo[3.2.1]octan-3-yl]urea.
| Compound Name | 1-(1-adamantyl)-3-[(1R,5S)-8-[(4-ethoxyphenyl)carbamothioyl]-8-azabicyclo[3.2.1]octan-3-yl]urea |
|---|---|
| PubChem CID | 25414893 |
| Molecular Formula | C27H38N4O2S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 1-(1-adamantyl)-3-[(1R,5S)-8-[(4-ethoxyphenyl)carbamothioyl]-8-azabicyclo[3.2.1]octan-3-yl]urea |
| SMILES | CCOc1ccc(NC(=S)N2[C@@H]3CC[C@H]2CC(NC(=O)NC24CC5CC(CC(C5)C2)C4)C3)cc1 |
| InChI | InChI=1S/C27H38N4O2S/c1-2-33-24-7-3-20(4-8-24)29-26(34)31-22-5-6-23(31)13-21(12-22)28-25(32)30-27-14-17-9-18(15-27)11-19(10-17)16-27/h3-4,7-8,17-19,21-23H,2,5-6,9-16H2,1H3,(H,29,34)(H2,28,30,32)/t17?,18?,19?,21?,22-,23+,27? |
| InChIKey | IPMNMIIPBXKKNP-QTBGHAFLSA-N |
| XLogP | 5.05 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|