C27H37N5O4 — CID 98111281
2-[(1R,5R)-3-(1-adamantylcarbamoylamino)-8-azabicyclo[3.2.1]octan-8-yl]-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 98111281) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is 2-[(1R,5R)-3-(1-adamantylcarbamoylamino)-8-azabicyclo[3.2.1]octan-8-yl]-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[(1R,5R)-3-(1-adamantylcarbamoylamino)-8-azabicyclo[3.2.1]octan-8-yl]-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 98111281 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 2-[(1R,5R)-3-(1-adamantylcarbamoylamino)-8-azabicyclo[3.2.1]octan-8-yl]-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CN1[C@@H]2CC[C@@H]1CC(NC(=O)NC13CC4CC(CC(C4)C1)C3)C2 |
| InChI | InChI=1S/C27H37N5O4/c1-16-6-23(32(35)36)4-5-24(16)29-25(33)15-31-21-2-3-22(31)11-20(10-21)28-26(34)30-27-12-17-7-18(13-27)9-19(8-17)14-27/h4-6,17-22H,2-3,7-15H2,1H3,(H,29,33)(H2,28,30,34)/t17?,18?,19?,21-,22-,27?/m1/s1 |
| InChIKey | MGRGFFNQRQXCDH-SFDMKYNQSA-N |
| XLogP | 4.11 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|