C22H31N5O4 — CID 3220680
2-[3-(cyclohexylcarbamoylamino)-8-azabicyclo[3.2.1]octan-8-yl]-N-(3-nitrophenyl)acetamide (PubChem CID 3220680) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-[3-(cyclohexylcarbamoylamino)-8-azabicyclo[3.2.1]octan-8-yl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[3-(cyclohexylcarbamoylamino)-8-azabicyclo[3.2.1]octan-8-yl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3220680 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-[3-(cyclohexylcarbamoylamino)-8-azabicyclo[3.2.1]octan-8-yl]-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(CN1C2CCC1CC(NC(=O)NC1CCCCC1)C2)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H31N5O4/c28-21(23-16-7-4-8-20(11-16)27(30)31)14-26-18-9-10-19(26)13-17(12-18)25-22(29)24-15-5-2-1-3-6-15/h4,7-8,11,15,17-19H,1-3,5-6,9-10,12-14H2,(H,23,28)(H2,24,25,29) |
| InChIKey | JRTIFWIDEILTKD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|