C20H24N6O4S — CID 90529527
2-[2-(cyclopentylcarbamoylamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-N-(3-nitrophenyl)acetamide (PubChem CID 90529527) has the molecular formula C20H24N6O4S and a molecular weight of 444.52 g/mol. Its IUPAC name is 2-[2-(cyclopentylcarbamoylamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[2-(cyclopentylcarbamoylamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 90529527 |
| Molecular Formula | C20H24N6O4S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-[2-(cyclopentylcarbamoylamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(CN1CCc2nc(NC(=O)NC3CCCC3)sc2C1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H24N6O4S/c27-18(21-14-6-3-7-15(10-14)26(29)30)12-25-9-8-16-17(11-25)31-20(23-16)24-19(28)22-13-4-1-2-5-13/h3,6-7,10,13H,1-2,4-5,8-9,11-12H2,(H,21,27)(H2,22,23,24,28) |
| InChIKey | XQVHUBHIKMBTHN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 129.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|