C30H44N2O5 — CID 70688854
[2-(2-ethoxyethoxy)-1-phenylethyl] 3-(1-adamantylcarbamoylamino)cyclohexane-1-carboxylate (PubChem CID 70688854) has the molecular formula C30H44N2O5 and a molecular weight of 512.69 g/mol. Its IUPAC name is [2-(2-ethoxyethoxy)-1-phenylethyl] 3-(1-adamantylcarbamoylamino)cyclohexane-1-carboxylate.
| Compound Name | [2-(2-ethoxyethoxy)-1-phenylethyl] 3-(1-adamantylcarbamoylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70688854 |
| Molecular Formula | C30H44N2O5 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | [2-(2-ethoxyethoxy)-1-phenylethyl] 3-(1-adamantylcarbamoylamino)cyclohexane-1-carboxylate |
| SMILES | CCOCCOCC(OC(=O)C1CCCC(NC(=O)NC23CC4CC(CC(C4)C2)C3)C1)c1ccccc1 |
| InChI | InChI=1S/C30H44N2O5/c1-2-35-11-12-36-20-27(24-7-4-3-5-8-24)37-28(33)25-9-6-10-26(16-25)31-29(34)32-30-17-21-13-22(18-30)15-23(14-21)19-30/h3-5,7-8,21-23,25-27H,2,6,9-20H2,1H3,(H2,31,32,34) |
| InChIKey | XZXDRKFTKGRSCE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|