C29H43NO6 — CID 67858011
2-[[1-[[(1S,3R)-3-ethoxycarbonylcyclohexyl]carbamoyl]cyclopentyl]methyl]-6-phenylmethoxyhexanoic acid (PubChem CID 67858011) has the molecular formula C29H43NO6 and a molecular weight of 501.66 g/mol. Its IUPAC name is 2-[[1-[[(1S,3R)-3-ethoxycarbonylcyclohexyl]carbamoyl]cyclopentyl]methyl]-6-phenylmethoxyhexanoic acid.
| Compound Name | 2-[[1-[[(1S,3R)-3-ethoxycarbonylcyclohexyl]carbamoyl]cyclopentyl]methyl]-6-phenylmethoxyhexanoic acid |
|---|---|
| PubChem CID | 67858011 |
| Molecular Formula | C29H43NO6 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | 2-[[1-[[(1S,3R)-3-ethoxycarbonylcyclohexyl]carbamoyl]cyclopentyl]methyl]-6-phenylmethoxyhexanoic acid |
| SMILES | CCOC(=O)[C@@H]1CCC[C@H](NC(=O)C2(CC(CCCCOCc3ccccc3)C(=O)O)CCCC2)C1 |
| InChI | InChI=1S/C29H43NO6/c1-2-36-27(33)23-14-10-15-25(19-23)30-28(34)29(16-7-8-17-29)20-24(26(31)32)13-6-9-18-35-21-22-11-4-3-5-12-22/h3-5,11-12,23-25H,2,6-10,13-21H2,1H3,(H,30,34)(H,31,32)/t23-,24?,25+/m1/s1 |
| InChIKey | HLWPVEAYCPEUCC-PPCJQXESSA-N |
| XLogP | 5.26 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|