C27H39NO6 — CID 19775811
4-ethoxy-2-[[1-[(4-phenylmethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]methyl]butanoic acid (PubChem CID 19775811) has the molecular formula C27H39NO6 and a molecular weight of 473.61 g/mol. Its IUPAC name is 4-ethoxy-2-[[1-[(4-phenylmethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]methyl]butanoic acid.
| Compound Name | 4-ethoxy-2-[[1-[(4-phenylmethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 19775811 |
| Molecular Formula | C27H39NO6 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | 4-ethoxy-2-[[1-[(4-phenylmethoxycarbonylcyclohexyl)carbamoyl]cyclopentyl]methyl]butanoic acid |
| SMILES | CCOCCC(CC1(C(=O)NC2CCC(C(=O)OCc3ccccc3)CC2)CCCC1)C(=O)O |
| InChI | InChI=1S/C27H39NO6/c1-2-33-17-14-22(24(29)30)18-27(15-6-7-16-27)26(32)28-23-12-10-21(11-13-23)25(31)34-19-20-8-4-3-5-9-20/h3-5,8-9,21-23H,2,6-7,10-19H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | YLQHXJXBFSRKOS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|