C29H37N3O5 — CID 59168687
ethyl 4-[[3-(1-adamantylcarbamoylamino)cyclohexanecarbonyl]oxy-cyanomethyl]benzoate (PubChem CID 59168687) has the molecular formula C29H37N3O5 and a molecular weight of 507.63 g/mol. Its IUPAC name is ethyl 4-[[3-(1-adamantylcarbamoylamino)cyclohexanecarbonyl]oxy-cyanomethyl]benzoate.
| Compound Name | ethyl 4-[[3-(1-adamantylcarbamoylamino)cyclohexanecarbonyl]oxy-cyanomethyl]benzoate |
|---|---|
| PubChem CID | 59168687 |
| Molecular Formula | C29H37N3O5 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | ethyl 4-[[3-(1-adamantylcarbamoylamino)cyclohexanecarbonyl]oxy-cyanomethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(C#N)OC(=O)C2CCCC(NC(=O)NC34CC5CC(CC(C5)C3)C4)C2)cc1 |
| InChI | InChI=1S/C29H37N3O5/c1-2-36-26(33)22-8-6-21(7-9-22)25(17-30)37-27(34)23-4-3-5-24(13-23)31-28(35)32-29-14-18-10-19(15-29)12-20(11-18)16-29/h6-9,18-20,23-25H,2-5,10-16H2,1H3,(H2,31,32,35) |
| InChIKey | VQRNZPWVDSZWQB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |