C15H27N3O — CID 25415305
1-[(1S,5R)-9-azabicyclo[3.3.1]nonan-3-yl]-3-cyclohexylurea (PubChem CID 25415305) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 1-[(1S,5R)-9-azabicyclo[3.3.1]nonan-3-yl]-3-cyclohexylurea.
| Compound Name | 1-[(1S,5R)-9-azabicyclo[3.3.1]nonan-3-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 25415305 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 1-[(1S,5R)-9-azabicyclo[3.3.1]nonan-3-yl]-3-cyclohexylurea |
| SMILES | O=C(NC1CCCCC1)NC1C[C@H]2CCC[C@@H](C1)N2 |
| InChI | InChI=1S/C15H27N3O/c19-15(17-11-5-2-1-3-6-11)18-14-9-12-7-4-8-13(10-14)16-12/h11-14,16H,1-10H2,(H2,17,18,19)/t12-,13+,14? |
| InChIKey | INCISGQVXFFBJL-PBWFPOADSA-N |
| XLogP | 2.29 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |