About N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide
N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide (PubChem CID 130690212) has the molecular formula C9H14F2N2O
and a molecular weight of 204.22 g/mol. Its IUPAC name is N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide |
| PubChem CID | 130690212 |
| Molecular Formula | C9H14F2N2O |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide |
| SMILES | O=C(NC1C[C@H]2CC[C@@H](C1)N2)C(F)F |
| InChI | InChI=1S/C9H14F2N2O/c10-8(11)9(14)13-7-3-5-1-2-6(4-7)12-5/h5-8,12H,1-4H2,(H,13,14)/t5-,6+,7? |
| InChIKey | OYQOEYDKLXKGGL-MEKDEQNOSA-N |
| XLogP | 0.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide?
The IUPAC name of N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide (CID 130690212) is N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide.
What is the SMILES notation for N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide?
The canonical SMILES for N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide is O=C(NC1C[C@H]2CC[C@@H](C1)N2)C(F)F.
What is the InChIKey of N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide?
The InChIKey is OYQOEYDKLXKGGL-MEKDEQNOSA-N. The full InChI is InChI=1S/C9H14F2N2O/c10-8(11)9(14)13-7-3-5-1-2-6(4-7)12-5/h5-8,12H,1-4H2,(H,13,14)/t5-,6+,7?.
What are the key properties of N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide?
N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide has a molecular weight of 204.22 g/mol, XLogP of 0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-2,2-difluoroacetamide is sourced from PubChem (CID 130690212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).