C14H27ClN2OS — CID 119459618
N-(8-azabicyclo[3.2.1]octan-3-yl)-2-ethylsulfanyl-3-methylbutanamide;hydrochloride (PubChem CID 119459618) has the molecular formula C14H27ClN2OS and a molecular weight of 306.90 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-2-ethylsulfanyl-3-methylbutanamide;hydrochloride.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-ethylsulfanyl-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119459618 |
| Molecular Formula | C14H27ClN2OS |
| Molecular Weight | 306.90 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-ethylsulfanyl-3-methylbutanamide;hydrochloride |
| SMILES | CCSC(C(=O)NC1CC2CCC(C1)N2)C(C)C.Cl |
| InChI | InChI=1S/C14H26N2OS.ClH/c1-4-18-13(9(2)3)14(17)16-12-7-10-5-6-11(8-12)15-10;/h9-13,15H,4-8H2,1-3H3,(H,16,17);1H |
| InChIKey | KXVJBNLRPUYNJU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.90 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |