C21H21NO5 — CID 23259359
(1R,2S)-4,5-dimethoxy-3-methylidenespiro[1H-indene-2,5'-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinoline]-1-ol (PubChem CID 23259359) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is (1R,2S)-4,5-dimethoxy-3-methylidenespiro[1H-indene-2,5'-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinoline]-1-ol.
| Compound Name | (1R,2S)-4,5-dimethoxy-3-methylidenespiro[1H-indene-2,5'-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinoline]-1-ol |
|---|---|
| PubChem CID | 23259359 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (1R,2S)-4,5-dimethoxy-3-methylidenespiro[1H-indene-2,5'-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinoline]-1-ol |
| SMILES | C=C1c2c(ccc(OC)c2OC)[C@@H](O)[C@]12NCCc1cc3c(cc12)OCO3 |
| InChI | InChI=1S/C21H21NO5/c1-11-18-13(4-5-15(24-2)19(18)25-3)20(23)21(11)14-9-17-16(26-10-27-17)8-12(14)6-7-22-21/h4-5,8-9,20,22-23H,1,6-7,10H2,2-3H3/t20-,21+/m1/s1 |
| InChIKey | DXEXRNIYXLXBTR-RTWAWAEBSA-N |
| XLogP | 2.53 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |