C20H19NO5 — CID 169445953
15-(trideuteriomethyl)-7,9,19,21-tetraoxa-15-azapentacyclo[15.7.0.04,12.06,10.018,22]tetracosa-1(17),4,6(10),11,18(22),23-hexaen-3-one (PubChem CID 169445953) has the molecular formula C20H19NO5 and a molecular weight of 356.39 g/mol. Its IUPAC name is 15-(trideuteriomethyl)-7,9,19,21-tetraoxa-15-azapentacyclo[15.7.0.04,12.06,10.018,22]tetracosa-1(17),4,6(10),11,18(22),23-hexaen-3-one.
| Compound Name | 15-(trideuteriomethyl)-7,9,19,21-tetraoxa-15-azapentacyclo[15.7.0.04,12.06,10.018,22]tetracosa-1(17),4,6(10),11,18(22),23-hexaen-3-one |
|---|---|
| PubChem CID | 169445953 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 15-(trideuteriomethyl)-7,9,19,21-tetraoxa-15-azapentacyclo[15.7.0.04,12.06,10.018,22]tetracosa-1(17),4,6(10),11,18(22),23-hexaen-3-one |
| SMILES | [2H]C([2H])([2H])N1CCc2cc3c(cc2C(=O)Cc2ccc4c(c2C1)OCO4)OCO3 |
| InChI | InChI=1S/C20H19NO5/c1-21-5-4-13-7-18-19(25-10-24-18)8-14(13)16(22)6-12-2-3-17-20(15(12)9-21)26-11-23-17/h2-3,7-8H,4-6,9-11H2,1H3/i1D3 |
| InChIKey | GPTFURBXHJWNHR-FIBGUPNXSA-N |
| XLogP | 2.56 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |