C20H22ClNO4 — CID 141255079
12-chloro-9,10-dimethoxy-1-methylperoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline (PubChem CID 141255079) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is 12-chloro-9,10-dimethoxy-1-methylperoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline.
| Compound Name | 12-chloro-9,10-dimethoxy-1-methylperoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
|---|---|
| PubChem CID | 141255079 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 12-chloro-9,10-dimethoxy-1-methylperoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
| SMILES | COOc1cccc2c1C1Cc3c(Cl)cc(OC)c(OC)c3CN1CC2 |
| InChI | InChI=1S/C20H22ClNO4/c1-23-18-10-15(21)13-9-16-19-12(5-4-6-17(19)26-25-3)7-8-22(16)11-14(13)20(18)24-2/h4-6,10,16H,7-9,11H2,1-3H3 |
| InChIKey | JDGLXUMCKJARMD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|