C16H15ClO3 — CID 151569744
1-chloro-3,4,5-trimethoxy-9H-fluorene (PubChem CID 151569744) has the molecular formula C16H15ClO3 and a molecular weight of 290.75 g/mol. Its IUPAC name is 1-chloro-3,4,5-trimethoxy-9H-fluorene.
| Compound Name | 1-chloro-3,4,5-trimethoxy-9H-fluorene |
|---|---|
| PubChem CID | 151569744 |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1-chloro-3,4,5-trimethoxy-9H-fluorene |
| SMILES | COc1cc(Cl)c2c(c1OC)-c1c(cccc1OC)C2 |
| InChI | InChI=1S/C16H15ClO3/c1-18-12-6-4-5-9-7-10-11(17)8-13(19-2)16(20-3)15(10)14(9)12/h4-6,8H,7H2,1-3H3 |
| InChIKey | QEEUAQXIRYHABO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |