About 1-chloro-3,4,5-trimethoxy-9H-fluorene
1-chloro-3,4,5-trimethoxy-9H-fluorene (PubChem CID 151569744) has the molecular formula C16H15ClO3
and a molecular weight of 290.75 g/mol. Its IUPAC name is 1-chloro-3,4,5-trimethoxy-9H-fluorene.
Molecular Properties
| Compound Name | 1-chloro-3,4,5-trimethoxy-9H-fluorene |
| PubChem CID | 151569744 |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1-chloro-3,4,5-trimethoxy-9H-fluorene |
| SMILES | COc1cc(Cl)c2c(c1OC)-c1c(cccc1OC)C2 |
| InChI | InChI=1S/C16H15ClO3/c1-18-12-6-4-5-9-7-10-11(17)8-13(19-2)16(20-3)15(10)14(9)12/h4-6,8H,7H2,1-3H3 |
| InChIKey | QEEUAQXIRYHABO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-chloro-3,4,5-trimethoxy-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3,4,5-trimethoxy-9H-fluorene?
The IUPAC name of 1-chloro-3,4,5-trimethoxy-9H-fluorene (CID 151569744) is 1-chloro-3,4,5-trimethoxy-9H-fluorene.
What is the SMILES notation for 1-chloro-3,4,5-trimethoxy-9H-fluorene?
The canonical SMILES for 1-chloro-3,4,5-trimethoxy-9H-fluorene is COc1cc(Cl)c2c(c1OC)-c1c(cccc1OC)C2.
What is the InChIKey of 1-chloro-3,4,5-trimethoxy-9H-fluorene?
The InChIKey is QEEUAQXIRYHABO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClO3/c1-18-12-6-4-5-9-7-10-11(17)8-13(19-2)16(20-3)15(10)14(9)12/h4-6,8H,7H2,1-3H3.
What are the key properties of 1-chloro-3,4,5-trimethoxy-9H-fluorene?
1-chloro-3,4,5-trimethoxy-9H-fluorene has a molecular weight of 290.75 g/mol, XLogP of 3.94, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3,4,5-trimethoxy-9H-fluorene is sourced from PubChem (CID 151569744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).