C20H23NO5 — CID 162984723
(13aS)-2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-1,11-diol (PubChem CID 162984723) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is (13aS)-2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-1,11-diol.
| Compound Name | (13aS)-2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-1,11-diol |
|---|---|
| PubChem CID | 162984723 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (13aS)-2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-1,11-diol |
| SMILES | COc1cc2c(cc1O)C[C@H]1c3c(cc(OC)c(OC)c3O)CCN1C2 |
| InChI | InChI=1S/C20H23NO5/c1-24-16-9-13-10-21-5-4-11-8-17(25-2)20(26-3)19(23)18(11)14(21)6-12(13)7-15(16)22/h7-9,14,22-23H,4-6,10H2,1-3H3/t14-/m0/s1 |
| InChIKey | GBJVLRZOHDGIGJ-AWEZNQCLSA-N |
| XLogP | 2.78 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|