C29H33NO4S — CID 145042384
(3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-11-yl) (E)-2-phenylethenesulfinate;ethane (PubChem CID 145042384) has the molecular formula C29H33NO4S and a molecular weight of 491.65 g/mol. Its IUPAC name is (3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-11-yl) (E)-2-phenylethenesulfinate;ethane.
| Compound Name | (3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-11-yl) (E)-2-phenylethenesulfinate;ethane |
|---|---|
| PubChem CID | 145042384 |
| Molecular Formula | C29H33NO4S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | (3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-11-yl) (E)-2-phenylethenesulfinate;ethane |
| SMILES | CC.COc1ccc2c(c1)CCN1Cc3cc(OC)c(OS(=O)/C=C/c4ccccc4)cc3CC21 |
| InChI | InChI=1S/C27H27NO4S.C2H6/c1-30-23-8-9-24-20(14-23)10-12-28-18-22-17-26(31-2)27(16-21(22)15-25(24)28)32-33(29)13-11-19-6-4-3-5-7-19;1-2/h3-9,11,13-14,16-17,25H,10,12,15,18H2,1-2H3;1-2H3/b13-11+; |
| InChIKey | KBAYHTITBVTHCN-BNSHTTSQSA-N |
| XLogP | 6.10 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |