C25H23F2NO3S — CID 145042349
11-(2,4-difluorophenyl)sulfanyloxy-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline (PubChem CID 145042349) has the molecular formula C25H23F2NO3S and a molecular weight of 455.53 g/mol. Its IUPAC name is 11-(2,4-difluorophenyl)sulfanyloxy-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline.
| Compound Name | 11-(2,4-difluorophenyl)sulfanyloxy-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
|---|---|
| PubChem CID | 145042349 |
| Molecular Formula | C25H23F2NO3S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 11-(2,4-difluorophenyl)sulfanyloxy-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
| SMILES | COc1ccc2c(c1)CCN1Cc3cc(OC)c(OSc4ccc(F)cc4F)cc3CC21 |
| InChI | InChI=1S/C25H23F2NO3S/c1-29-19-4-5-20-15(9-19)7-8-28-14-17-12-23(30-2)24(11-16(17)10-22(20)28)31-32-25-6-3-18(26)13-21(25)27/h3-6,9,11-13,22H,7-8,10,14H2,1-2H3 |
| InChIKey | IFSDQWOFUMRDDJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|