C24H20FNO5S2 — CID 145042395
18-(3-fluorophenyl)sulfanyloxy-17-methoxy-5,7-dioxa-6λ4-thia-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene 6-oxide (PubChem CID 145042395) has the molecular formula C24H20FNO5S2 and a molecular weight of 485.56 g/mol. Its IUPAC name is 18-(3-fluorophenyl)sulfanyloxy-17-methoxy-5,7-dioxa-6λ4-thia-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene 6-oxide.
| Compound Name | 18-(3-fluorophenyl)sulfanyloxy-17-methoxy-5,7-dioxa-6λ4-thia-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene 6-oxide |
|---|---|
| PubChem CID | 145042395 |
| Molecular Formula | C24H20FNO5S2 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 18-(3-fluorophenyl)sulfanyloxy-17-methoxy-5,7-dioxa-6λ4-thia-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene 6-oxide |
| SMILES | COc1cc2c(cc1OSc1cccc(F)c1)CC1c3cc4c(cc3CCN1C2)OS(=O)O4 |
| InChI | InChI=1S/C24H20FNO5S2/c1-28-21-10-16-13-26-6-5-14-8-23-24(31-33(27)30-23)12-19(14)20(26)7-15(16)9-22(21)29-32-18-4-2-3-17(25)11-18/h2-4,8-12,20H,5-7,13H2,1H3 |
| InChIKey | PXJDEEMLFVTURM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|