C26H24FNO5S — CID 145042644
(19-methoxy-5,8-dioxa-14-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,17,19,21-hexaen-20-yl) 3-fluorobenzenesulfinate (PubChem CID 145042644) has the molecular formula C26H24FNO5S and a molecular weight of 481.55 g/mol. Its IUPAC name is (19-methoxy-5,8-dioxa-14-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,17,19,21-hexaen-20-yl) 3-fluorobenzenesulfinate.
| Compound Name | (19-methoxy-5,8-dioxa-14-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,17,19,21-hexaen-20-yl) 3-fluorobenzenesulfinate |
|---|---|
| PubChem CID | 145042644 |
| Molecular Formula | C26H24FNO5S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (19-methoxy-5,8-dioxa-14-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,17,19,21-hexaen-20-yl) 3-fluorobenzenesulfinate |
| SMILES | COc1cc2c(cc1OS(=O)c1cccc(F)c1)C1Cc3c(ccc4c3OCCO4)CN1CC2 |
| InChI | InChI=1S/C26H24FNO5S/c1-30-24-11-16-7-8-28-15-17-5-6-23-26(32-10-9-31-23)21(17)13-22(28)20(16)14-25(24)33-34(29)19-4-2-3-18(27)12-19/h2-6,11-12,14,22H,7-10,13,15H2,1H3 |
| InChIKey | CGTDQMAZKVGHCC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |