C30H35N3O6S — CID 166057031
[(14R)-17-methoxy-5,8-dioxa-1-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),10,15,17,19-hexaen-18-yl] 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate (PubChem CID 166057031) has the molecular formula C30H35N3O6S and a molecular weight of 565.69 g/mol. Its IUPAC name is [(14R)-17-methoxy-5,8-dioxa-1-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),10,15,17,19-hexaen-18-yl] 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate.
| Compound Name | [(14R)-17-methoxy-5,8-dioxa-1-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),10,15,17,19-hexaen-18-yl] 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 166057031 |
| Molecular Formula | C30H35N3O6S |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | [(14R)-17-methoxy-5,8-dioxa-1-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),10,15,17,19-hexaen-18-yl] 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate |
| SMILES | COc1cc2c(cc1OC(=O)CCCCC1SCC3NC(=O)NC31)CCN1Cc3c(ccc4c3OCCO4)C[C@H]21 |
| InChI | InChI=1S/C30H35N3O6S/c1-36-24-14-19-18(8-9-33-15-20-17(12-22(19)33)6-7-23-29(20)38-11-10-37-23)13-25(24)39-27(34)5-3-2-4-26-28-21(16-40-26)31-30(35)32-28/h6-7,13-14,21-22,26,28H,2-5,8-12,15-16H2,1H3,(H2,31,32,35)/t21?,22-,26?,28?/m1/s1 |
| InChIKey | UVMDOQMRPBTDTC-RGSBBMEXSA-N |
| XLogP | 3.75 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|