C33H41FN2O5S — CID 145042430
[2,10-dimethoxy-12-(piperidin-1-ylmethyl)-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl] 3-fluorobenzenesulfinate;methoxymethane (PubChem CID 145042430) has the molecular formula C33H41FN2O5S and a molecular weight of 596.77 g/mol. Its IUPAC name is [2,10-dimethoxy-12-(piperidin-1-ylmethyl)-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl] 3-fluorobenzenesulfinate;methoxymethane.
| Compound Name | [2,10-dimethoxy-12-(piperidin-1-ylmethyl)-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl] 3-fluorobenzenesulfinate;methoxymethane |
|---|---|
| PubChem CID | 145042430 |
| Molecular Formula | C33H41FN2O5S |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | [2,10-dimethoxy-12-(piperidin-1-ylmethyl)-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl] 3-fluorobenzenesulfinate;methoxymethane |
| SMILES | COC.COc1ccc2c(c1)C1Cc3c(CN4CCCCC4)cc(OC)c(OS(=O)c4cccc(F)c4)c3CN1CC2 |
| InChI | InChI=1S/C31H35FN2O4S.C2H6O/c1-36-24-10-9-21-11-14-34-20-28-26(18-29(34)27(21)17-24)22(19-33-12-4-3-5-13-33)15-30(37-2)31(28)38-39(35)25-8-6-7-23(32)16-25;1-3-2/h6-10,15-17,29H,3-5,11-14,18-20H2,1-2H3;1-2H3 |
| InChIKey | AKJDCOFQAJICDH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |