C29H31FN2O3 — CID 145375359
1-fluoro-4-(methoxymethyl)benzene;(19-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16(21),17,19-heptaen-10-yl)methanol (PubChem CID 145375359) has the molecular formula C29H31FN2O3 and a molecular weight of 474.58 g/mol. Its IUPAC name is 1-fluoro-4-(methoxymethyl)benzene;(19-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16(21),17,19-heptaen-10-yl)methanol.
| Compound Name | 1-fluoro-4-(methoxymethyl)benzene;(19-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16(21),17,19-heptaen-10-yl)methanol |
|---|---|
| PubChem CID | 145375359 |
| Molecular Formula | C29H31FN2O3 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 1-fluoro-4-(methoxymethyl)benzene;(19-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16(21),17,19-heptaen-10-yl)methanol |
| SMILES | COCc1ccc(F)cc1.COc1ccc2c(c1)C1Cc3c(n(CO)c4ccccc34)CN1CC2 |
| InChI | InChI=1S/C21H22N2O2.C8H9FO/c1-25-15-7-6-14-8-9-22-12-21-18(11-20(22)17(14)10-15)16-4-2-3-5-19(16)23(21)13-24;1-10-6-7-2-4-8(9)5-3-7/h2-7,10,20,24H,8-9,11-13H2,1H3;2-5H,6H2,1H3 |
| InChIKey | XPEJBVUDDKZTIN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 46.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|