C26H32N2O4 — CID 131978788
(18-butoxy-6,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl)methanol (PubChem CID 131978788) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is (18-butoxy-6,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl)methanol.
| Compound Name | (18-butoxy-6,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl)methanol |
|---|---|
| PubChem CID | 131978788 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | (18-butoxy-6,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl)methanol |
| SMILES | CCCCOc1cc2c(cc1OC)C1Cc3c(n(CO)c4ccc(OC)cc34)CN1CC2 |
| InChI | InChI=1S/C26H32N2O4/c1-4-5-10-32-26-11-17-8-9-27-15-24-21(13-23(27)19(17)14-25(26)31-3)20-12-18(30-2)6-7-22(20)28(24)16-29/h6-7,11-12,14,23,29H,4-5,8-10,13,15-16H2,1-3H3 |
| InChIKey | PEIJZLYPHDMWPK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 56.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|