C29H31FN2O3 — CID 138751773
[5-fluoro-19-methoxy-18-[(2E,4Z)-2-methylhepta-2,4,6-trienoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol (PubChem CID 138751773) has the molecular formula C29H31FN2O3 and a molecular weight of 474.58 g/mol. Its IUPAC name is [5-fluoro-19-methoxy-18-[(2E,4Z)-2-methylhepta-2,4,6-trienoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol.
| Compound Name | [5-fluoro-19-methoxy-18-[(2E,4Z)-2-methylhepta-2,4,6-trienoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol |
|---|---|
| PubChem CID | 138751773 |
| Molecular Formula | C29H31FN2O3 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [5-fluoro-19-methoxy-18-[(2E,4Z)-2-methylhepta-2,4,6-trienoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol |
| SMILES | C=C/C=C\C=C(/C)COc1cc2c(cc1OC)C1Cc3c(n(CO)c4cccc(F)c34)CN1CC2 |
| InChI | InChI=1S/C29H31FN2O3/c1-4-5-6-8-19(2)17-35-28-13-20-11-12-31-16-26-22(14-25(31)21(20)15-27(28)34-3)29-23(30)9-7-10-24(29)32(26)18-33/h4-10,13,15,25,33H,1,11-12,14,16-18H2,2-3H3/b6-5-,19-8+ |
| InChIKey | CCIUZYAJLYVDNH-PWOUCLHYSA-N |
| XLogP | 5.46 |
| TPSA | 46.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|