C20H23NO4S — CID 46633684
2-(2,4-dimethoxyphenyl)-1-[(E)-2-phenylethenyl]sulfonylpyrrolidine (PubChem CID 46633684) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-1-[(E)-2-phenylethenyl]sulfonylpyrrolidine.
| Compound Name | 2-(2,4-dimethoxyphenyl)-1-[(E)-2-phenylethenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 46633684 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-1-[(E)-2-phenylethenyl]sulfonylpyrrolidine |
| SMILES | COc1ccc(C2CCCN2S(=O)(=O)/C=C/c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C20H23NO4S/c1-24-17-10-11-18(20(15-17)25-2)19-9-6-13-21(19)26(22,23)14-12-16-7-4-3-5-8-16/h3-5,7-8,10-12,14-15,19H,6,9,13H2,1-2H3/b14-12+ |
| InChIKey | NAZMUTXTHOCLRD-WYMLVPIESA-N |
| XLogP | 3.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |