C22H22F3NO3 — CID 46636836
(E)-1-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 46636836) has the molecular formula C22H22F3NO3 and a molecular weight of 405.42 g/mol. Its IUPAC name is (E)-1-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46636836 |
| Molecular Formula | C22H22F3NO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (E)-1-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(C2CCCN2C(=O)/C=C/c2cccc(C(F)(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C22H22F3NO3/c1-28-17-9-10-18(20(14-17)29-2)19-7-4-12-26(19)21(27)11-8-15-5-3-6-16(13-15)22(23,24)25/h3,5-6,8-11,13-14,19H,4,7,12H2,1-2H3/b11-8+ |
| InChIKey | VLMJFUCRJNVEPQ-DHZHZOJOSA-N |
| XLogP | 5.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|