C28H37NO11 — CID 16637698
(2R,3R)-2,3-dihydroxy-2,3-dimethylbutanedioic acid;2,3,9,10,11-pentamethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline (PubChem CID 16637698) has the molecular formula C28H37NO11 and a molecular weight of 563.60 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-2,3-dimethylbutanedioic acid;2,3,9,10,11-pentamethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline.
| Compound Name | (2R,3R)-2,3-dihydroxy-2,3-dimethylbutanedioic acid;2,3,9,10,11-pentamethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
|---|---|
| PubChem CID | 16637698 |
| Molecular Formula | C28H37NO11 |
| Molecular Weight | 563.60 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-2,3-dimethylbutanedioic acid;2,3,9,10,11-pentamethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
| SMILES | COc1cc2c(cc1OC)C1Cc3cc(OC)c(OC)c(OC)c3CN1CC2.C[C@](O)(C(=O)O)[C@@](C)(O)C(=O)O |
| InChI | InChI=1S/C22H27NO5.C6H10O6/c1-24-18-9-13-6-7-23-12-16-14(8-17(23)15(13)11-19(18)25-2)10-20(26-3)22(28-5)21(16)27-4;1-5(11,3(7)8)6(2,12)4(9)10/h9-11,17H,6-8,12H2,1-5H3;11-12H,1-2H3,(H,7,8)(H,9,10)/t;5-,6-/m.0/s1 |
| InChIKey | QWCPDIJCGMSVMZ-LOLRQIBTSA-N |
| XLogP | 2.04 |
| TPSA | 164.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.60 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |