C20H26N2O — CID 172506186
(1R,15S,17S)-7-methoxy-16-propan-2-yl-3,13-diazapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraene (PubChem CID 172506186) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is (1R,15S,17S)-7-methoxy-16-propan-2-yl-3,13-diazapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraene.
| Compound Name | (1R,15S,17S)-7-methoxy-16-propan-2-yl-3,13-diazapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraene |
|---|---|
| PubChem CID | 172506186 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (1R,15S,17S)-7-methoxy-16-propan-2-yl-3,13-diazapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraene |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN1C[C@H]2C[C@@H]3[C@@H]1C2C(C)C |
| InChI | InChI=1S/C20H26N2O/c1-11(2)18-12-8-16-19-14(6-7-22(10-12)20(16)18)15-9-13(23-3)4-5-17(15)21-19/h4-5,9,11-12,16,18,20-21H,6-8,10H2,1-3H3/t12-,16+,18?,20-/m1/s1 |
| InChIKey | YZAXRZYOQLFBOZ-PIATWEBUSA-N |
| XLogP | 3.79 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |