C16H20N2O — CID 164872491
7-methoxy-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraene (PubChem CID 164872491) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 7-methoxy-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraene.
| Compound Name | 7-methoxy-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraene |
|---|---|
| PubChem CID | 164872491 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 7-methoxy-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraene |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN1CCCC3C1 |
| InChI | InChI=1S/C16H20N2O/c1-19-12-4-5-15-14(9-12)13-6-8-18-7-2-3-11(10-18)16(13)17-15/h4-5,9,11,17H,2-3,6-8,10H2,1H3 |
| InChIKey | YHVRLKBUXFUDGD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |