C16H17F3N2 — CID 170406532
6-(trifluoromethyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraene (PubChem CID 170406532) has the molecular formula C16H17F3N2 and a molecular weight of 294.32 g/mol. Its IUPAC name is 6-(trifluoromethyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraene.
| Compound Name | 6-(trifluoromethyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraene |
|---|---|
| PubChem CID | 170406532 |
| Molecular Formula | C16H17F3N2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 6-(trifluoromethyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraene |
| SMILES | FC(F)(F)c1ccc2c3c([nH]c2c1)C1CCCN(CC3)C1 |
| InChI | InChI=1S/C16H17F3N2/c17-16(18,19)11-3-4-12-13-5-7-21-6-1-2-10(9-21)15(13)20-14(12)8-11/h3-4,8,10,20H,1-2,5-7,9H2 |
| InChIKey | CMTOQDAHCSXQES-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |