C16H20N2O2 — CID 164872654
7,9-dioxa-3,16-diazapentacyclo[14.3.1.02,13.04,12.06,10]icosa-2(13),4,6(10),11-tetraene;molecular hydrogen (PubChem CID 164872654) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 7,9-dioxa-3,16-diazapentacyclo[14.3.1.02,13.04,12.06,10]icosa-2(13),4,6(10),11-tetraene;molecular hydrogen.
| Compound Name | 7,9-dioxa-3,16-diazapentacyclo[14.3.1.02,13.04,12.06,10]icosa-2(13),4,6(10),11-tetraene;molecular hydrogen |
|---|---|
| PubChem CID | 164872654 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 7,9-dioxa-3,16-diazapentacyclo[14.3.1.02,13.04,12.06,10]icosa-2(13),4,6(10),11-tetraene;molecular hydrogen |
| SMILES | [H][H].c1c2c(cc3c4c([nH]c13)C1CCCN(CC4)C1)OCO2 |
| InChI | InChI=1S/C16H18N2O2.H2/c1-2-10-8-18(4-1)5-3-11-12-6-14-15(20-9-19-14)7-13(12)17-16(10)11;/h6-7,10,17H,1-5,8-9H2;1H |
| InChIKey | JGRKVQHZCKTSEU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |