C22H19NO4 — CID 51352358
(8S)-14,16,23,25-tetraoxa-4-azaheptacyclo[18.7.0.02,10.04,8.011,19.013,17.022,26]heptacosa-1(27),2(10),11,13(17),18,20,22(26)-heptaene (PubChem CID 51352358) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is (8S)-14,16,23,25-tetraoxa-4-azaheptacyclo[18.7.0.02,10.04,8.011,19.013,17.022,26]heptacosa-1(27),2(10),11,13(17),18,20,22(26)-heptaene.
| Compound Name | (8S)-14,16,23,25-tetraoxa-4-azaheptacyclo[18.7.0.02,10.04,8.011,19.013,17.022,26]heptacosa-1(27),2(10),11,13(17),18,20,22(26)-heptaene |
|---|---|
| PubChem CID | 51352358 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (8S)-14,16,23,25-tetraoxa-4-azaheptacyclo[18.7.0.02,10.04,8.011,19.013,17.022,26]heptacosa-1(27),2(10),11,13(17),18,20,22(26)-heptaene |
| SMILES | c1c2c(cc3c1c1c(c4cc5c(cc43)OCO5)CN3CCC[C@H]3C1)OCO2 |
| InChI | InChI=1S/C22H19NO4/c1-2-12-4-13-14-5-19-20(25-10-24-19)6-15(14)16-7-21-22(27-11-26-21)8-17(16)18(13)9-23(12)3-1/h5-8,12H,1-4,9-11H2/t12-/m0/s1 |
| InChIKey | GDFCGBDOHRGMNY-LBPRGKRZSA-N |
| XLogP | 3.97 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|