C15H18N2 — CID 124581684
(1S)-7-methyl-3,12-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene (PubChem CID 124581684) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is (1S)-7-methyl-3,12-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene.
| Compound Name | (1S)-7-methyl-3,12-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene |
|---|---|
| PubChem CID | 124581684 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | (1S)-7-methyl-3,12-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CN1CCC[C@H]3C1 |
| InChI | InChI=1S/C15H18N2/c1-10-4-5-14-12(7-10)13-9-17-6-2-3-11(8-17)15(13)16-14/h4-5,7,11,16H,2-3,6,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | LFDQXPAHZHIZKV-NSHDSACASA-N |
| XLogP | 3.17 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |