C16H18N2O — CID 10332547
9-methyl-2,3,4,6,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-7-one (PubChem CID 10332547) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 9-methyl-2,3,4,6,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-7-one.
| Compound Name | 9-methyl-2,3,4,6,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-7-one |
|---|---|
| PubChem CID | 10332547 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 9-methyl-2,3,4,6,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-7-one |
| SMILES | Cc1ccc2[nH]c3c(c2c1)C(=O)CN1CCCCC31 |
| InChI | InChI=1S/C16H18N2O/c1-10-5-6-12-11(8-10)15-14(19)9-18-7-3-2-4-13(18)16(15)17-12/h5-6,8,13,17H,2-4,7,9H2,1H3 |
| InChIKey | PSWDYYQHEWLHGF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |