C16H19F3N2 — CID 164872566
3-ethyl-10-(trifluoromethyl)-1,2,4,5,6,7-hexahydroazocino[5,4-b]indole (PubChem CID 164872566) has the molecular formula C16H19F3N2 and a molecular weight of 296.34 g/mol. Its IUPAC name is 3-ethyl-10-(trifluoromethyl)-1,2,4,5,6,7-hexahydroazocino[5,4-b]indole.
| Compound Name | 3-ethyl-10-(trifluoromethyl)-1,2,4,5,6,7-hexahydroazocino[5,4-b]indole |
|---|---|
| PubChem CID | 164872566 |
| Molecular Formula | C16H19F3N2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 3-ethyl-10-(trifluoromethyl)-1,2,4,5,6,7-hexahydroazocino[5,4-b]indole |
| SMILES | CCN1CCCc2[nH]c3ccc(C(F)(F)F)cc3c2CC1 |
| InChI | InChI=1S/C16H19F3N2/c1-2-21-8-3-4-14-12(7-9-21)13-10-11(16(17,18)19)5-6-15(13)20-14/h5-6,10,20H,2-4,7-9H2,1H3 |
| InChIKey | IBNNMVXRAGHMMQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|