C15H14F3NO2 — CID 154108491
2-[6-(trifluoromethyl)-2,3,4,9-tetrahydro-1H-carbazol-2-yl]acetic acid (PubChem CID 154108491) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-[6-(trifluoromethyl)-2,3,4,9-tetrahydro-1H-carbazol-2-yl]acetic acid.
| Compound Name | 2-[6-(trifluoromethyl)-2,3,4,9-tetrahydro-1H-carbazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 154108491 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[6-(trifluoromethyl)-2,3,4,9-tetrahydro-1H-carbazol-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCc2c([nH]c3ccc(C(F)(F)F)cc23)C1 |
| InChI | InChI=1S/C15H14F3NO2/c16-15(17,18)9-2-4-12-11(7-9)10-3-1-8(6-14(20)21)5-13(10)19-12/h2,4,7-8,19H,1,3,5-6H2,(H,20,21) |
| InChIKey | XZMMLSPXNHWGGX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|