C16H16ClNO4 — CID 23463663
2-[(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)methyl]propanedioic acid (PubChem CID 23463663) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is 2-[(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)methyl]propanedioic acid.
| Compound Name | 2-[(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 23463663 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-[(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)methyl]propanedioic acid |
| SMILES | O=C(O)C(CC1CCc2c([nH]c3ccc(Cl)cc23)C1)C(=O)O |
| InChI | InChI=1S/C16H16ClNO4/c17-9-2-4-13-11(7-9)10-3-1-8(6-14(10)18-13)5-12(15(19)20)16(21)22/h2,4,7-8,12,18H,1,3,5-6H2,(H,19,20)(H,21,22) |
| InChIKey | PJAKXEAHOKHKMD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|