C21H21ClN2O — CID 11638914
6-chloro-N-[(1S)-1-phenylethyl]-2,3,4,9-tetrahydro-1H-carbazole-2-carboxamide (PubChem CID 11638914) has the molecular formula C21H21ClN2O and a molecular weight of 352.87 g/mol. Its IUPAC name is 6-chloro-N-[(1S)-1-phenylethyl]-2,3,4,9-tetrahydro-1H-carbazole-2-carboxamide.
| Compound Name | 6-chloro-N-[(1S)-1-phenylethyl]-2,3,4,9-tetrahydro-1H-carbazole-2-carboxamide |
|---|---|
| PubChem CID | 11638914 |
| Molecular Formula | C21H21ClN2O |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 6-chloro-N-[(1S)-1-phenylethyl]-2,3,4,9-tetrahydro-1H-carbazole-2-carboxamide |
| SMILES | C[C@H](NC(=O)C1CCc2c([nH]c3ccc(Cl)cc23)C1)c1ccccc1 |
| InChI | InChI=1S/C21H21ClN2O/c1-13(14-5-3-2-4-6-14)23-21(25)15-7-9-17-18-12-16(22)8-10-19(18)24-20(17)11-15/h2-6,8,10,12-13,15,24H,7,9,11H2,1H3,(H,23,25)/t13-,15?/m0/s1 |
| InChIKey | MPERVPHPXKETOG-CFMCSPIPSA-N |
| XLogP | 4.80 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|