C20H16ClFN2O2S — CID 11315631
2-(benzenesulfonyl)-2-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)-2-fluoroacetonitrile (PubChem CID 11315631) has the molecular formula C20H16ClFN2O2S and a molecular weight of 402.88 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)-2-fluoroacetonitrile.
| Compound Name | 2-(benzenesulfonyl)-2-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)-2-fluoroacetonitrile |
|---|---|
| PubChem CID | 11315631 |
| Molecular Formula | C20H16ClFN2O2S |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 2-(benzenesulfonyl)-2-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)-2-fluoroacetonitrile |
| SMILES | N#CC(F)(C1CCc2c([nH]c3ccc(Cl)cc23)C1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16ClFN2O2S/c21-14-7-9-18-17(11-14)16-8-6-13(10-19(16)24-18)20(22,12-23)27(25,26)15-4-2-1-3-5-15/h1-5,7,9,11,13,24H,6,8,10H2 |
| InChIKey | LVBGLUIYTGZQAA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|